C24H20O4 — CID 68977211
methyl 4-[2-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]ethenyl]benzoate (PubChem CID 68977211) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl 4-[2-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-[2-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 68977211 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | methyl 4-[2-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(C=Cc2ccc(C=Cc3ccc(O)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C24H20O4/c1-28-24(27)21-13-10-19(11-14-21)7-6-17-2-4-18(5-3-17)8-9-20-12-15-22(25)23(26)16-20/h2-16,25-26H,1H3 |
| InChIKey | RJYGFWVUVAZIDE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|