C46H38O6 — CID 135273845
methyl 4-[(E)-2-[4,5-bis[(E)-2-(4-acetylphenyl)ethenyl]-2-[(E)-2-(4-methoxycarbonylphenyl)ethenyl]phenyl]ethenyl]benzoate (PubChem CID 135273845) has the molecular formula C46H38O6 and a molecular weight of 686.80 g/mol. Its IUPAC name is methyl 4-[(E)-2-[4,5-bis[(E)-2-(4-acetylphenyl)ethenyl]-2-[(E)-2-(4-methoxycarbonylphenyl)ethenyl]phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-[(E)-2-[4,5-bis[(E)-2-(4-acetylphenyl)ethenyl]-2-[(E)-2-(4-methoxycarbonylphenyl)ethenyl]phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 135273845 |
| Molecular Formula | C46H38O6 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | methyl 4-[(E)-2-[4,5-bis[(E)-2-(4-acetylphenyl)ethenyl]-2-[(E)-2-(4-methoxycarbonylphenyl)ethenyl]phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/c2cc(/C=C/c3ccc(C(C)=O)cc3)c(/C=C/c3ccc(C(C)=O)cc3)cc2/C=C/c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C46H38O6/c1-31(47)37-17-5-33(6-18-37)13-25-41-29-43(27-15-35-9-21-39(22-10-35)45(49)51-3)44(28-16-36-11-23-40(24-12-36)46(50)52-4)30-42(41)26-14-34-7-19-38(20-8-34)32(2)48/h5-30H,1-4H3/b25-13+,26-14+,27-15+,28-16+ |
| InChIKey | YKFDCOZIJJTOOF-BRJCPHQQSA-N |
| XLogP | 10.35 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|