C21H22N2O5 — CID 163551722
methyl 4-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]piperazin-1-yl]benzoate (PubChem CID 163551722) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 4-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 4-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 163551722 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl 4-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)/C=C/c3ccc(O)c(O)c3)CC2)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-28-21(27)16-4-6-17(7-5-16)22-10-12-23(13-11-22)20(26)9-3-15-2-8-18(24)19(25)14-15/h2-9,14,24-25H,10-13H2,1H3/b9-3+ |
| InChIKey | FJQJJVFLALISDI-YCRREMRBSA-N |
| XLogP | 2.25 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|