C21H23N3O5 — CID 166279815
methyl 5-[(E)-3-[4-(3-hydroxy-4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]pyridine-2-carboxylate (PubChem CID 166279815) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 5-[(E)-3-[4-(3-hydroxy-4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[(E)-3-[4-(3-hydroxy-4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166279815 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | methyl 5-[(E)-3-[4-(3-hydroxy-4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)N2CCN(c3ccc(OC)c(O)c3)CC2)cn1 |
| InChI | InChI=1S/C21H23N3O5/c1-28-19-7-5-16(13-18(19)25)23-9-11-24(12-10-23)20(26)8-4-15-3-6-17(22-14-15)21(27)29-2/h3-8,13-14,25H,9-12H2,1-2H3/b8-4+ |
| InChIKey | DKIMTORDFBKTQB-XBXARRHUSA-N |
| XLogP | 1.94 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|