C18H20N4O3S — CID 108729462
methyl 4-[(E)-3-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]benzoate (PubChem CID 108729462) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is methyl 4-[(E)-3-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 108729462 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | methyl 4-[(E)-3-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)N2CCN(c3nnc(C)s3)CC2)cc1 |
| InChI | InChI=1S/C18H20N4O3S/c1-13-19-20-18(26-13)22-11-9-21(10-12-22)16(23)8-5-14-3-6-15(7-4-14)17(24)25-2/h3-8H,9-12H2,1-2H3/b8-5+ |
| InChIKey | CUYLCTSXLHRQQR-VMPITWQZSA-N |
| XLogP | 2.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|