C22H18O4 — CID 71680339
4-[(E)-2-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]phenyl]ethenyl]benzene-1,2-diol (PubChem CID 71680339) has the molecular formula C22H18O4 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]phenyl]ethenyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-2-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]phenyl]ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 71680339 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]phenyl]ethenyl]benzene-1,2-diol |
| SMILES | Oc1ccc(/C=C/c2ccc(/C=C/c3ccc(O)c(O)c3)cc2)cc1O |
| InChI | InChI=1S/C22H18O4/c23-19-11-9-17(13-21(19)25)7-5-15-1-2-16(4-3-15)6-8-18-10-12-20(24)22(26)14-18/h1-14,23-26H/b7-5+,8-6+ |
| InChIKey | RCNLWBWFWORIOB-KQQUZDAGSA-N |
| XLogP | 4.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|