C17H16BrClN2O — CID 108908999
1-[(E)-2-(4-bromophenyl)ethenyl]-3-[2-(4-chlorophenyl)ethyl]urea (PubChem CID 108908999) has the molecular formula C17H16BrClN2O and a molecular weight of 379.69 g/mol. Its IUPAC name is 1-[(E)-2-(4-bromophenyl)ethenyl]-3-[2-(4-chlorophenyl)ethyl]urea.
| Compound Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-3-[2-(4-chlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108908999 |
| Molecular Formula | C17H16BrClN2O |
| Molecular Weight | 379.69 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-3-[2-(4-chlorophenyl)ethyl]urea |
| SMILES | O=C(N/C=C/c1ccc(Br)cc1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16BrClN2O/c18-15-5-1-13(2-6-15)9-11-20-17(22)21-12-10-14-3-7-16(19)8-4-14/h1-9,11H,10,12H2,(H2,20,21,22)/b11-9+ |
| InChIKey | BZIUSVUHQUTKGY-PKNBQFBNSA-N |
| XLogP | 4.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |