C18H19FN2O — CID 108908257
1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[2-(4-methylphenyl)ethyl]urea (PubChem CID 108908257) has the molecular formula C18H19FN2O and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[2-(4-methylphenyl)ethyl]urea.
| Compound Name | 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[2-(4-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108908257 |
| Molecular Formula | C18H19FN2O |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[2-(4-methylphenyl)ethyl]urea |
| SMILES | Cc1ccc(CCNC(=O)N/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN2O/c1-14-2-4-15(5-3-14)10-12-20-18(22)21-13-11-16-6-8-17(19)9-7-16/h2-9,11,13H,10,12H2,1H3,(H2,20,21,22)/b13-11+ |
| InChIKey | SQGGSXPPQGJBJO-ACCUITESSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |