C13H17FN2O3 — CID 108908090
1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[2-(2-hydroxyethoxy)ethyl]urea (PubChem CID 108908090) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[2-(2-hydroxyethoxy)ethyl]urea.
| Compound Name | 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[2-(2-hydroxyethoxy)ethyl]urea |
|---|---|
| PubChem CID | 108908090 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[2-(2-hydroxyethoxy)ethyl]urea |
| SMILES | O=C(N/C=C/c1ccc(F)cc1)NCCOCCO |
| InChI | InChI=1S/C13H17FN2O3/c14-12-3-1-11(2-4-12)5-6-15-13(18)16-7-9-19-10-8-17/h1-6,17H,7-10H2,(H2,15,16,18)/b6-5+ |
| InChIKey | GYRPYXXOURXGCK-AATRIKPKSA-N |
| XLogP | 1.10 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|