C29H38BrN3O4 — CID 67495725
tert-butyl 3-[2-[[(1R,2R,3R,4S)-3-[(4-bromophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]ethyl]piperidine-1-carboxylate (PubChem CID 67495725) has the molecular formula C29H38BrN3O4 and a molecular weight of 572.54 g/mol. Its IUPAC name is tert-butyl 3-[2-[[(1R,2R,3R,4S)-3-[(4-bromophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[[(1R,2R,3R,4S)-3-[(4-bromophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67495725 |
| Molecular Formula | C29H38BrN3O4 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | tert-butyl 3-[2-[[(1R,2R,3R,4S)-3-[(4-bromophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CCNC(=O)[C@H]2[C@H](C(=O)Nc3ccc(Br)cc3)[C@@H]3C=C[C@H]2C32CC2)C1 |
| InChI | InChI=1S/C29H38BrN3O4/c1-28(2,3)37-27(36)33-16-4-5-18(17-33)12-15-31-25(34)23-21-10-11-22(29(21)13-14-29)24(23)26(35)32-20-8-6-19(30)7-9-20/h6-11,18,21-24H,4-5,12-17H2,1-3H3,(H,31,34)(H,32,35)/t18?,21-,22+,23-,24-/m1/s1 |
| InChIKey | WAHBMZWURNRRBS-PQMZZMCRSA-N |
| XLogP | 5.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|