C26H36BrN3O2 — CID 67495379
(1S,2R,3R,4R)-2-N-(4-bromophenyl)-3-N-[5-(diethylamino)pentan-2-yl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67495379) has the molecular formula C26H36BrN3O2 and a molecular weight of 502.50 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-N-(4-bromophenyl)-3-N-[5-(diethylamino)pentan-2-yl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-2-N-(4-bromophenyl)-3-N-[5-(diethylamino)pentan-2-yl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67495379 |
| Molecular Formula | C26H36BrN3O2 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | (1S,2R,3R,4R)-2-N-(4-bromophenyl)-3-N-[5-(diethylamino)pentan-2-yl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C26H36BrN3O2/c1-4-30(5-2)16-6-7-17(3)28-24(31)22-20-12-13-21(26(20)14-15-26)23(22)25(32)29-19-10-8-18(27)9-11-19/h8-13,17,20-23H,4-7,14-16H2,1-3H3,(H,28,31)(H,29,32)/t17?,20-,21+,22-,23-/m1/s1 |
| InChIKey | VJQMMJXRAPFMBC-IJQZUKMQSA-N |
| XLogP | 4.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|