C27H37BrN4O2 — CID 67495605
(1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[4-(4-methyl-1,4-diazepan-1-yl)butyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67495605) has the molecular formula C27H37BrN4O2 and a molecular weight of 529.52 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[4-(4-methyl-1,4-diazepan-1-yl)butyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[4-(4-methyl-1,4-diazepan-1-yl)butyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67495605 |
| Molecular Formula | C27H37BrN4O2 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[4-(4-methyl-1,4-diazepan-1-yl)butyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CN1CCCN(CCCCNC(=O)[C@H]2[C@H](C(=O)Nc3ccc(Br)cc3)[C@@H]3C=C[C@H]2C32CC2)CC1 |
| InChI | InChI=1S/C27H37BrN4O2/c1-31-14-4-16-32(18-17-31)15-3-2-13-29-25(33)23-21-9-10-22(27(21)11-12-27)24(23)26(34)30-20-7-5-19(28)6-8-20/h5-10,21-24H,2-4,11-18H2,1H3,(H,29,33)(H,30,34)/t21-,22+,23-,24-/m1/s1 |
| InChIKey | YVKHGTZYCVGOAW-UEQSERJNSA-N |
| XLogP | 3.75 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|