C12H16N4O3 — CID 43259753
3-[2-(5-amino-2-oxo-1-pyridinyl)ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 43259753) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[2-(5-amino-2-oxo-1-pyridinyl)ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(5-amino-2-oxo-1-pyridinyl)ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43259753 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-[2-(5-amino-2-oxo-1-pyridinyl)ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCn2cc(N)ccc2=O)C1=O |
| InChI | InChI=1S/C12H16N4O3/c1-12(2)10(18)16(11(19)14-12)6-5-15-7-8(13)3-4-9(15)17/h3-4,7H,5-6,13H2,1-2H3,(H,14,19) |
| InChIKey | GMHFKKXINQYOOY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|