C10H19N3O2 — CID 61387575
5,5-dimethyl-3-[2-(propylamino)ethyl]imidazolidine-2,4-dione (PubChem CID 61387575) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-(propylamino)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-(propylamino)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 61387575 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 5,5-dimethyl-3-[2-(propylamino)ethyl]imidazolidine-2,4-dione |
| SMILES | CCCNCCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C10H19N3O2/c1-4-5-11-6-7-13-8(14)10(2,3)12-9(13)15/h11H,4-7H2,1-3H3,(H,12,15) |
| InChIKey | VBPXBMHKFYTOSL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|