C13H26N3O2+ — CID 158812623
butyl-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]-dimethylazanium (PubChem CID 158812623) has the molecular formula C13H26N3O2+ and a molecular weight of 256.37 g/mol. Its IUPAC name is butyl-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]-dimethylazanium.
| Compound Name | butyl-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 158812623 |
| Molecular Formula | C13H26N3O2+ |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | butyl-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]-dimethylazanium |
| SMILES | CCCC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C13H25N3O2/c1-6-7-9-16(4,5)10-8-15-11(17)13(2,3)14-12(15)18/h6-10H2,1-5H3/p+1 |
| InChIKey | WFSVZHCQDNZFEE-UHFFFAOYSA-O |
| XLogP | 1.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|