C12H22ClN3O2 — CID 161165619
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride (PubChem CID 161165619) has the molecular formula C12H22ClN3O2 and a molecular weight of 275.78 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride |
|---|---|
| PubChem CID | 161165619 |
| Molecular Formula | C12H22ClN3O2 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride |
| SMILES | C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O.[Cl-] |
| InChI | InChI=1S/C12H21N3O2.ClH/c1-6-8-15(4,5)9-7-14-10(16)12(2,3)13-11(14)17;/h6H,1,7-9H2,2-5H3;1H |
| InChIKey | XORLHXHIRUAZIP-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|