About 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride (PubChem CID 161165619) has the molecular formula C12H22ClN3O2
and a molecular weight of 275.78 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride |
| PubChem CID | 161165619 |
| Molecular Formula | C12H22ClN3O2 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride |
| SMILES | C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O.[Cl-] |
| InChI | InChI=1S/C12H21N3O2.ClH/c1-6-8-15(4,5)9-7-14-10(16)12(2,3)13-11(14)17;/h6H,1,7-9H2,2-5H3;1H |
| InChIKey | XORLHXHIRUAZIP-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride?
The IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride (CID 161165619) is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride.
What is the SMILES notation for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride?
The canonical SMILES for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride is C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O.[Cl-].
What is the InChIKey of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride?
The InChIKey is XORLHXHIRUAZIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2.ClH/c1-6-8-15(4,5)9-7-14-10(16)12(2,3)13-11(14)17;/h6H,1,7-9H2,2-5H3;1H.
What are the key properties of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride?
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride has a molecular weight of 275.78 g/mol, XLogP of -2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium chloride is sourced from PubChem (CID 161165619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).