About 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium (PubChem CID 157049530) has the molecular formula C36H66N9O6+3
and a molecular weight of 720.98 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium |
| PubChem CID | 157049530 |
| Molecular Formula | C36H66N9O6+3 |
| Molecular Weight | 720.98 g/mol |
| Exact Mass | 720.51 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium |
| SMILES | C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O.C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O.C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/3C12H21N3O2/c3*1-6-8-15(4,5)9-7-14-10(16)12(2,3)13-11(14)17/h3*6H,1,7-9H2,2-5H3/p+3 |
| InChIKey | FDPKEYIJYFVGSG-UHFFFAOYSA-Q |
| XLogP | 1.74 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 720.98 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium?
The IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium (CID 157049530) is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium.
What is the SMILES notation for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium?
The canonical SMILES for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium is C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O.C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O.C=CC[N+](C)(C)CCN1C(=O)NC(C)(C)C1=O.
What is the InChIKey of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium?
The InChIKey is FDPKEYIJYFVGSG-UHFFFAOYSA-Q. The full InChI is InChI=1S/3C12H21N3O2/c3*1-6-8-15(4,5)9-7-14-10(16)12(2,3)13-11(14)17/h3*6H,1,7-9H2,2-5H3/p+3.
What are the key properties of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium?
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium has a molecular weight of 720.98 g/mol, XLogP of 1.74, 15 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-dimethyl-prop-2-enylazanium is sourced from PubChem (CID 157049530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).