C12H20F3N3O3 — CID 115475773
3-[3-(tert-butylamino)-2-hydroxypropyl]-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 115475773) has the molecular formula C12H20F3N3O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 3-[3-(tert-butylamino)-2-hydroxypropyl]-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[3-(tert-butylamino)-2-hydroxypropyl]-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 115475773 |
| Molecular Formula | C12H20F3N3O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-[3-(tert-butylamino)-2-hydroxypropyl]-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)NCC(O)CN1C(=O)NC(C)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C12H20F3N3O3/c1-10(2,3)16-5-7(19)6-18-8(20)11(4,12(13,14)15)17-9(18)21/h7,16,19H,5-6H2,1-4H3,(H,17,21) |
| InChIKey | LTWDZJAGUQYOLB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|