C8H11F3N2O4 — CID 82849872
3-(2,3-dihydroxypropyl)-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 82849872) has the molecular formula C8H11F3N2O4 and a molecular weight of 256.18 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | 3-(2,3-dihydroxypropyl)-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82849872 |
| Molecular Formula | C8H11F3N2O4 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | CC1(C(F)(F)F)NC(=O)N(CC(O)CO)C1=O |
| InChI | InChI=1S/C8H11F3N2O4/c1-7(8(9,10)11)5(16)13(6(17)12-7)2-4(15)3-14/h4,14-15H,2-3H2,1H3,(H,12,17) |
| InChIKey | UESQFIZMFWAIPI-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|