C10H17N3O4 — CID 18931375
3-(2,3-dihydroxypropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 18931375) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2,3-dihydroxypropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 18931375 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCNCC2)C(=O)N1CC(O)CO |
| InChI | InChI=1S/C10H17N3O4/c14-6-7(15)5-13-8(16)10(12-9(13)17)1-3-11-4-2-10/h7,11,14-15H,1-6H2,(H,12,17) |
| InChIKey | AYLLZYHNZACYKU-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|