C11H17BrN2O3 — CID 112560051
3-(3-bromo-2-hydroxypropyl)-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 112560051) has the molecular formula C11H17BrN2O3 and a molecular weight of 305.17 g/mol. Its IUPAC name is 3-(3-bromo-2-hydroxypropyl)-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(3-bromo-2-hydroxypropyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 112560051 |
| Molecular Formula | C11H17BrN2O3 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-(3-bromo-2-hydroxypropyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1CC(O)CBr |
| InChI | InChI=1S/C11H17BrN2O3/c12-6-8(15)7-14-9(16)11(13-10(14)17)4-2-1-3-5-11/h8,15H,1-7H2,(H,13,17) |
| InChIKey | HBELUWZPJXLQID-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|