C16H19BrN2O2 — CID 65014536
3-(3-bromo-2-phenylpropyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 65014536) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 3-(3-bromo-2-phenylpropyl)-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-(3-bromo-2-phenylpropyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 65014536 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 3-(3-bromo-2-phenylpropyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1CC(CBr)c1ccccc1 |
| InChI | InChI=1S/C16H19BrN2O2/c17-10-13(12-6-2-1-3-7-12)11-19-14(20)16(18-15(19)21)8-4-5-9-16/h1-3,6-7,13H,4-5,8-11H2,(H,18,21) |
| InChIKey | GXWDRXKRZRHWRO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|