C11H17BrN2O2 — CID 64995551
3-(3-bromo-2-methylpropyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 64995551) has the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. Its IUPAC name is 3-(3-bromo-2-methylpropyl)-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-(3-bromo-2-methylpropyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 64995551 |
| Molecular Formula | C11H17BrN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-(3-bromo-2-methylpropyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC(CBr)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C11H17BrN2O2/c1-8(6-12)7-14-9(15)11(13-10(14)16)4-2-3-5-11/h8H,2-7H2,1H3,(H,13,16) |
| InChIKey | PGOJTWOHNCZSTM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|