C11H15BrN2O4 — CID 81091939
methyl 2-bromo-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate (PubChem CID 81091939) has the molecular formula C11H15BrN2O4 and a molecular weight of 319.16 g/mol. Its IUPAC name is methyl 2-bromo-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate.
| Compound Name | methyl 2-bromo-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate |
|---|---|
| PubChem CID | 81091939 |
| Molecular Formula | C11H15BrN2O4 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | methyl 2-bromo-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate |
| SMILES | COC(=O)C(Br)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C11H15BrN2O4/c1-18-8(15)7(12)6-14-9(16)11(13-10(14)17)4-2-3-5-11/h7H,2-6H2,1H3,(H,13,17) |
| InChIKey | XLRDDNYALKKQNC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|