C18H27N3O7 — CID 8653906
methyl (2R)-2-[[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]amino]-4-methylpentanoate (PubChem CID 8653906) has the molecular formula C18H27N3O7 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl (2R)-2-[[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 8653906 |
| Molecular Formula | C18H27N3O7 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | methyl (2R)-2-[[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)COC(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C18H27N3O7/c1-11(2)8-12(15(24)27-3)19-13(22)10-28-14(23)9-21-16(25)18(20-17(21)26)6-4-5-7-18/h11-12H,4-10H2,1-3H3,(H,19,22)(H,20,26)/t12-/m1/s1 |
| InChIKey | WKHUUTGVIPKMOZ-GFCCVEGCSA-N |
| XLogP | 0.10 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|