C17H22BrN3O3 — CID 123236329
3-[2-(4-bromoanilino)-2-hydroxyethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 123236329) has the molecular formula C17H22BrN3O3 and a molecular weight of 396.29 g/mol. Its IUPAC name is 3-[2-(4-bromoanilino)-2-hydroxyethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-[2-(4-bromoanilino)-2-hydroxyethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 123236329 |
| Molecular Formula | C17H22BrN3O3 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3-[2-(4-bromoanilino)-2-hydroxyethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | O=C1NC2(CCCCCC2)C(=O)N1CC(O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H22BrN3O3/c18-12-5-7-13(8-6-12)19-14(22)11-21-15(23)17(20-16(21)24)9-3-1-2-4-10-17/h5-8,14,19,22H,1-4,9-11H2,(H,20,24) |
| InChIKey | HJXRNAYUOCUKMO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|