C19H26N2O4 — CID 31569830
3-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 31569830) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 31569830 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | Cc1ccc(OC[C@@H](O)CN2C(=O)NC3(CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-14-6-8-16(9-7-14)25-13-15(22)12-21-17(23)19(20-18(21)24)10-4-2-3-5-11-19/h6-9,15,22H,2-5,10-13H2,1H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | ZPGPWNKXMLIHEI-HNNXBMFYSA-N |
| XLogP | 2.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|