C17H22N2O6 — CID 21238579
[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl] 2-(4-methylphenoxy)acetate (PubChem CID 21238579) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is [3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl] 2-(4-methylphenoxy)acetate.
| Compound Name | [3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl] 2-(4-methylphenoxy)acetate |
|---|---|
| PubChem CID | 21238579 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl] 2-(4-methylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)OCC(O)CN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C17H22N2O6/c1-11-4-6-13(7-5-11)24-10-14(21)25-9-12(20)8-19-15(22)17(2,3)18-16(19)23/h4-7,12,20H,8-10H2,1-3H3,(H,18,23) |
| InChIKey | WZNSKSBSMNUUCS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|