C16H20N2O5 — CID 21238567
[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl] 2-phenylacetate (PubChem CID 21238567) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is [3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl] 2-phenylacetate.
| Compound Name | [3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl] 2-phenylacetate |
|---|---|
| PubChem CID | 21238567 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl] 2-phenylacetate |
| SMILES | CC1(C)NC(=O)N(CC(O)COC(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H20N2O5/c1-16(2)14(21)18(15(22)17-16)9-12(19)10-23-13(20)8-11-6-4-3-5-7-11/h3-7,12,19H,8-10H2,1-2H3,(H,17,22) |
| InChIKey | ISNQONXZWYVZGW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|