C17H22N2O4 — CID 750544
3-[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 750544) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 750544 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | C=CCc1ccccc1OC[C@@H](O)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C17H22N2O4/c1-4-7-12-8-5-6-9-14(12)23-11-13(20)10-19-15(21)17(2,3)18-16(19)22/h4-6,8-9,13,20H,1,7,10-11H2,2-3H3,(H,18,22)/t13-/m0/s1 |
| InChIKey | TYDOGTWUTRFOEM-ZDUSSCGKSA-N |
| XLogP | 1.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|