C17H28NO2+ — CID 6543364
[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-dimethyl-propan-2-ylazanium (PubChem CID 6543364) has the molecular formula C17H28NO2+ and a molecular weight of 278.42 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-dimethyl-propan-2-ylazanium.
| Compound Name | [(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-dimethyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 6543364 |
| Molecular Formula | C17H28NO2+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-dimethyl-propan-2-ylazanium |
| SMILES | C=CCc1ccccc1OC[C@@H](O)C[N+](C)(C)C(C)C |
| InChI | InChI=1S/C17H28NO2/c1-6-9-15-10-7-8-11-17(15)20-13-16(19)12-18(4,5)14(2)3/h6-8,10-11,14,16,19H,1,9,12-13H2,2-5H3/q+1/t16-/m0/s1 |
| InChIKey | LTPNWBALAIEAHJ-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|