C12H16O2 — CID 70371312
1-(2-prop-2-enylphenoxy)propan-1-ol (PubChem CID 70371312) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(2-prop-2-enylphenoxy)propan-1-ol.
| Compound Name | 1-(2-prop-2-enylphenoxy)propan-1-ol |
|---|---|
| PubChem CID | 70371312 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 1-(2-prop-2-enylphenoxy)propan-1-ol |
| SMILES | C=CCc1ccccc1OC(O)CC |
| InChI | InChI=1S/C12H16O2/c1-3-7-10-8-5-6-9-11(10)14-12(13)4-2/h3,5-6,8-9,12-13H,1,4,7H2,2H3 |
| InChIKey | RCQJHGSVWIGFCW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|