C22H38N2O6 — CID 155566405
1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-3-(2-prop-2-enylphenoxy)propan-2-ol (PubChem CID 155566405) has the molecular formula C22H38N2O6 and a molecular weight of 426.55 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-3-(2-prop-2-enylphenoxy)propan-2-ol.
| Compound Name | 1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-3-(2-prop-2-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 155566405 |
| Molecular Formula | C22H38N2O6 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-3-(2-prop-2-enylphenoxy)propan-2-ol |
| SMILES | C=CCc1ccccc1OCC(O)CNCCOCCOCCOCCOCCN |
| InChI | InChI=1S/C22H38N2O6/c1-2-5-20-6-3-4-7-22(20)30-19-21(25)18-24-9-11-27-13-15-29-17-16-28-14-12-26-10-8-23/h2-4,6-7,21,24-25H,1,5,8-19,23H2 |
| InChIKey | JTICSMPQQVDYOJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|