C29H38N2O6 — CID 153397125
1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-3-[3,4-bis(phenylmethoxy)phenoxy]propan-2-ol (PubChem CID 153397125) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is 1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-3-[3,4-bis(phenylmethoxy)phenoxy]propan-2-ol.
| Compound Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-3-[3,4-bis(phenylmethoxy)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 153397125 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-3-[3,4-bis(phenylmethoxy)phenoxy]propan-2-ol |
| SMILES | NCCOCCOCCNCC(O)COc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H38N2O6/c30-13-15-33-17-18-34-16-14-31-20-26(32)23-35-27-11-12-28(36-21-24-7-3-1-4-8-24)29(19-27)37-22-25-9-5-2-6-10-25/h1-12,19,26,31-32H,13-18,20-23,30H2 |
| InChIKey | JTKJNXMWZCJFHH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|