C16H28N2O4 — CID 23349125
1-(2-aminoethylamino)-3-[4-(2-propoxyethoxy)phenoxy]propan-2-ol (PubChem CID 23349125) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(2-aminoethylamino)-3-[4-(2-propoxyethoxy)phenoxy]propan-2-ol.
| Compound Name | 1-(2-aminoethylamino)-3-[4-(2-propoxyethoxy)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 23349125 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-(2-aminoethylamino)-3-[4-(2-propoxyethoxy)phenoxy]propan-2-ol |
| SMILES | CCCOCCOc1ccc(OCC(O)CNCCN)cc1 |
| InChI | InChI=1S/C16H28N2O4/c1-2-9-20-10-11-21-15-3-5-16(6-4-15)22-13-14(19)12-18-8-7-17/h3-6,14,18-19H,2,7-13,17H2,1H3 |
| InChIKey | YOWTXNKCIVWQAO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|