C19H32N2O4 — CID 54292131
(2S)-1-(2-aminoethylamino)-3-[4-[2-[2-(cyclopropylmethoxy)ethoxy]ethyl]phenoxy]propan-2-ol (PubChem CID 54292131) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2S)-1-(2-aminoethylamino)-3-[4-[2-[2-(cyclopropylmethoxy)ethoxy]ethyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-(2-aminoethylamino)-3-[4-[2-[2-(cyclopropylmethoxy)ethoxy]ethyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 54292131 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (2S)-1-(2-aminoethylamino)-3-[4-[2-[2-(cyclopropylmethoxy)ethoxy]ethyl]phenoxy]propan-2-ol |
| SMILES | NCCNC[C@H](O)COc1ccc(CCOCCOCC2CC2)cc1 |
| InChI | InChI=1S/C19H32N2O4/c20-8-9-21-13-18(22)15-25-19-5-3-16(4-6-19)7-10-23-11-12-24-14-17-1-2-17/h3-6,17-18,21-22H,1-2,7-15,20H2/t18-/m0/s1 |
| InChIKey | RYGASCTWRDTSAA-SFHVURJKSA-N |
| XLogP | 0.96 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|