C16H24BrNO3 — CID 103603711
1-(3-bromophenoxy)-3-[3-(cyclopropylmethoxy)propylamino]propan-2-ol (PubChem CID 103603711) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-3-[3-(cyclopropylmethoxy)propylamino]propan-2-ol.
| Compound Name | 1-(3-bromophenoxy)-3-[3-(cyclopropylmethoxy)propylamino]propan-2-ol |
|---|---|
| PubChem CID | 103603711 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-(3-bromophenoxy)-3-[3-(cyclopropylmethoxy)propylamino]propan-2-ol |
| SMILES | OC(CNCCCOCC1CC1)COc1cccc(Br)c1 |
| InChI | InChI=1S/C16H24BrNO3/c17-14-3-1-4-16(9-14)21-12-15(19)10-18-7-2-8-20-11-13-5-6-13/h1,3-4,9,13,15,18-19H,2,5-8,10-12H2 |
| InChIKey | BEILMHRIGUBTJE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|