C12H15BrF3NO2S — CID 106429304
1-(3-bromophenoxy)-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol (PubChem CID 106429304) has the molecular formula C12H15BrF3NO2S and a molecular weight of 374.22 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol.
| Compound Name | 1-(3-bromophenoxy)-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 106429304 |
| Molecular Formula | C12H15BrF3NO2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-(3-bromophenoxy)-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol |
| SMILES | OC(CNCCSC(F)(F)F)COc1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrF3NO2S/c13-9-2-1-3-11(6-9)19-8-10(18)7-17-4-5-20-12(14,15)16/h1-3,6,10,17-18H,4-5,7-8H2 |
| InChIKey | YBDKAQMCMQUPNR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|