C17H28BrNO2 — CID 115567734
1-(3-bromophenoxy)-3-(octylamino)propan-2-ol (PubChem CID 115567734) has the molecular formula C17H28BrNO2 and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-3-(octylamino)propan-2-ol.
| Compound Name | 1-(3-bromophenoxy)-3-(octylamino)propan-2-ol |
|---|---|
| PubChem CID | 115567734 |
| Molecular Formula | C17H28BrNO2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-(3-bromophenoxy)-3-(octylamino)propan-2-ol |
| SMILES | CCCCCCCCNCC(O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C17H28BrNO2/c1-2-3-4-5-6-7-11-19-13-16(20)14-21-17-10-8-9-15(18)12-17/h8-10,12,16,19-20H,2-7,11,13-14H2,1H3 |
| InChIKey | VSERWLOMSBXOMY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|