C13H16BrNO2 — CID 113464617
1-(3-bromophenoxy)-3-(but-2-ynylamino)propan-2-ol (PubChem CID 113464617) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-3-(but-2-ynylamino)propan-2-ol.
| Compound Name | 1-(3-bromophenoxy)-3-(but-2-ynylamino)propan-2-ol |
|---|---|
| PubChem CID | 113464617 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 1-(3-bromophenoxy)-3-(but-2-ynylamino)propan-2-ol |
| SMILES | CC#CCNCC(O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C13H16BrNO2/c1-2-3-7-15-9-12(16)10-17-13-6-4-5-11(14)8-13/h4-6,8,12,15-16H,7,9-10H2,1H3 |
| InChIKey | FDGRXXCUWWOJOS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|