C15H24BrNO3 — CID 4555054
1-(3-bromophenoxy)-3-(3-propan-2-yloxypropylamino)propan-2-ol (PubChem CID 4555054) has the molecular formula C15H24BrNO3 and a molecular weight of 346.27 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-3-(3-propan-2-yloxypropylamino)propan-2-ol.
| Compound Name | 1-(3-bromophenoxy)-3-(3-propan-2-yloxypropylamino)propan-2-ol |
|---|---|
| PubChem CID | 4555054 |
| Molecular Formula | C15H24BrNO3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-(3-bromophenoxy)-3-(3-propan-2-yloxypropylamino)propan-2-ol |
| SMILES | CC(C)OCCCNCC(O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C15H24BrNO3/c1-12(2)19-8-4-7-17-10-14(18)11-20-15-6-3-5-13(16)9-15/h3,5-6,9,12,14,17-18H,4,7-8,10-11H2,1-2H3 |
| InChIKey | NBYCYDOYMAPKHC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|