C20H33NO5 — CID 170341079
acetic acid;1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 170341079) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is acetic acid;1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | acetic acid;1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 170341079 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | acetic acid;1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(=O)O.CC(C)NCC(O)COc1ccc(CCOCC2CC2)cc1 |
| InChI | InChI=1S/C18H29NO3.C2H4O2/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16;1-2(3)4/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3;1H3,(H,3,4) |
| InChIKey | GFSWUGQVHLMBSF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|