C21H31NO7 — CID 158038084
(Z)-but-2-enedioic acid;1-(propan-2-ylamino)-3-[4-(2-prop-2-enoxyethyl)phenoxy]propan-2-ol (PubChem CID 158038084) has the molecular formula C21H31NO7 and a molecular weight of 409.48 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(propan-2-ylamino)-3-[4-(2-prop-2-enoxyethyl)phenoxy]propan-2-ol.
| Compound Name | (Z)-but-2-enedioic acid;1-(propan-2-ylamino)-3-[4-(2-prop-2-enoxyethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 158038084 |
| Molecular Formula | C21H31NO7 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(propan-2-ylamino)-3-[4-(2-prop-2-enoxyethyl)phenoxy]propan-2-ol |
| SMILES | C=CCOCCc1ccc(OCC(O)CNC(C)C)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H27NO3.C4H4O4/c1-4-10-20-11-9-15-5-7-17(8-6-15)21-13-16(19)12-18-14(2)3;5-3(6)1-2-4(7)8/h4-8,14,16,18-19H,1,9-13H2,2-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VRKICVWVOYWBEQ-BTJKTKAUSA-N |
| XLogP | 1.88 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|