C16H29NO4 — CID 175047598
methanol;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 175047598) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is methanol;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | methanol;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 175047598 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | methanol;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CO.COCCc1ccc(OCC(O)CNC(C)C)cc1 |
| InChI | InChI=1S/C15H25NO3.CH4O/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3;1-2/h4-7,12,14,16-17H,8-11H2,1-3H3;2H,1H3 |
| InChIKey | LRURBIUGVSJKBC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |