C16H30BNO5 — CID 22295643
1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol;methylboronic acid (PubChem CID 22295643) has the molecular formula C16H30BNO5 and a molecular weight of 327.23 g/mol. Its IUPAC name is 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol;methylboronic acid.
| Compound Name | 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol;methylboronic acid |
|---|---|
| PubChem CID | 22295643 |
| Molecular Formula | C16H30BNO5 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol;methylboronic acid |
| SMILES | CB(O)O.COCCc1ccc(OCC(O)CNC(C)C)cc1 |
| InChI | InChI=1S/C15H25NO3.CH5BO2/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3;1-2(3)4/h4-7,12,14,16-17H,8-11H2,1-3H3;3-4H,1H3 |
| InChIKey | FIAYCIQMORHDKY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|