C16H27NO4 — CID 25186198
(2S)-2-[[(2R)-2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]amino]butan-1-ol (PubChem CID 25186198) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]amino]butan-1-ol.
| Compound Name | (2S)-2-[[(2R)-2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 25186198 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (2S)-2-[[(2R)-2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]amino]butan-1-ol |
| SMILES | CC[C@@H](CO)NC[C@@H](O)COc1ccc(CCOC)cc1 |
| InChI | InChI=1S/C16H27NO4/c1-3-14(11-18)17-10-15(19)12-21-16-6-4-13(5-7-16)8-9-20-2/h4-7,14-15,17-19H,3,8-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | XLGJYMKLZDZQPJ-LSDHHAIUSA-N |
| XLogP | 0.98 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |