C18H30NO3+ — CID 24849134
[(2S)-3-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-2-hydroxypropyl]-propan-2-ylazanium (PubChem CID 24849134) has the molecular formula C18H30NO3+ and a molecular weight of 308.44 g/mol. Its IUPAC name is [(2S)-3-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-2-hydroxypropyl]-propan-2-ylazanium.
| Compound Name | [(2S)-3-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-2-hydroxypropyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 24849134 |
| Molecular Formula | C18H30NO3+ |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | [(2S)-3-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-2-hydroxypropyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+]C[C@H](O)COc1ccc(CCOCC2CC2)cc1 |
| InChI | InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | NWIUTZDMDHAVTP-KRWDZBQOSA-O |
| XLogP | 1.37 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|