C18H30NO4+ — CID 86308160
[(2S)-3-[4-[2-(cyclopropylmethoxy)ethoxy]phenoxy]-2-hydroxypropyl]-propan-2-ylazanium (PubChem CID 86308160) has the molecular formula C18H30NO4+ and a molecular weight of 324.44 g/mol. Its IUPAC name is [(2S)-3-[4-[2-(cyclopropylmethoxy)ethoxy]phenoxy]-2-hydroxypropyl]-propan-2-ylazanium.
| Compound Name | [(2S)-3-[4-[2-(cyclopropylmethoxy)ethoxy]phenoxy]-2-hydroxypropyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 86308160 |
| Molecular Formula | C18H30NO4+ |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | [(2S)-3-[4-[2-(cyclopropylmethoxy)ethoxy]phenoxy]-2-hydroxypropyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+]C[C@H](O)COc1ccc(OCCOCC2CC2)cc1 |
| InChI | InChI=1S/C18H29NO4/c1-14(2)19-11-16(20)13-23-18-7-5-17(6-8-18)22-10-9-21-12-15-3-4-15/h5-8,14-16,19-20H,3-4,9-13H2,1-2H3/p+1/t16-/m0/s1 |
| InChIKey | JNDJPKHYZWRRIS-INIZCTEOSA-O |
| XLogP | 1.20 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|