C16H24O7S — CID 88683858
(3S)-4-[4-[2-(cyclopropylmethoxy)ethoxy]phenoxy]-3-hydroxybutane-1-sulfonic acid (PubChem CID 88683858) has the molecular formula C16H24O7S and a molecular weight of 360.43 g/mol. Its IUPAC name is (3S)-4-[4-[2-(cyclopropylmethoxy)ethoxy]phenoxy]-3-hydroxybutane-1-sulfonic acid.
| Compound Name | (3S)-4-[4-[2-(cyclopropylmethoxy)ethoxy]phenoxy]-3-hydroxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 88683858 |
| Molecular Formula | C16H24O7S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (3S)-4-[4-[2-(cyclopropylmethoxy)ethoxy]phenoxy]-3-hydroxybutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CC[C@H](O)COc1ccc(OCCOCC2CC2)cc1 |
| InChI | InChI=1S/C16H24O7S/c17-14(7-10-24(18,19)20)12-23-16-5-3-15(4-6-16)22-9-8-21-11-13-1-2-13/h3-6,13-14,17H,1-2,7-12H2,(H,18,19,20)/t14-/m0/s1 |
| InChIKey | GTFUHKXXFFEMSJ-AWEZNQCLSA-N |
| XLogP | 1.51 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|