C26H38O16S4 — CID 122471101
2-[4-[2-[2-[2-[2-[2-[4-(2-sulfoethylsulfonyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]sulfonylethanesulfonic acid (PubChem CID 122471101) has the molecular formula C26H38O16S4 and a molecular weight of 734.84 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-[2-[2-[4-(2-sulfoethylsulfonyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]sulfonylethanesulfonic acid.
| Compound Name | 2-[4-[2-[2-[2-[2-[2-[4-(2-sulfoethylsulfonyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]sulfonylethanesulfonic acid |
|---|---|
| PubChem CID | 122471101 |
| Molecular Formula | C26H38O16S4 |
| Molecular Weight | 734.84 g/mol |
| Exact Mass | 734.10 |
| IUPAC Name | 2-[4-[2-[2-[2-[2-[2-[4-(2-sulfoethylsulfonyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]sulfonylethanesulfonic acid |
| SMILES | O=S(=O)(O)CCS(=O)(=O)c1ccc(OCCOCCOCCOCCOCCOc2ccc(S(=O)(=O)CCS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H38O16S4/c27-43(28,19-21-45(31,32)33)25-5-1-23(2-6-25)41-17-15-39-13-11-37-9-10-38-12-14-40-16-18-42-24-3-7-26(8-4-24)44(29,30)20-22-46(34,35)36/h1-8H,9-22H2,(H,31,32,33)(H,34,35,36) |
| InChIKey | SWHVGCNQTVZIHQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 232.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.84 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|